C22H32F5N3O5 — CID 10436464
tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[(5,5,6,6,6-pentafluoro-2-methyl-4-oxohex-2-en-3-yl)carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 10436464) has the molecular formula C22H32F5N3O5 and a molecular weight of 513.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[(5,5,6,6,6-pentafluoro-2-methyl-4-oxohex-2-en-3-yl)carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[(5,5,6,6,6-pentafluoro-2-methyl-4-oxohex-2-en-3-yl)carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 10436464 |
| Molecular Formula | C22H32F5N3O5 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[(5,5,6,6,6-pentafluoro-2-methyl-4-oxohex-2-en-3-yl)carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)=C(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H32F5N3O5/c1-11(2)14(16(31)21(23,24)22(25,26)27)28-17(32)13-9-8-10-30(13)18(33)15(12(3)4)29-19(34)35-20(5,6)7/h12-13,15H,8-10H2,1-7H3,(H,28,32)(H,29,34)/t13-,15-/m0/s1 |
| InChIKey | HZKCUFKSGPAMDH-ZFWWWQNUSA-N |
| XLogP | 3.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|