C25H39F9N3O7P — CID 121266489
tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[1-[2,2,3,3,3-pentafluoropropoxy(2,2,3,3-tetrafluoropropoxy)phosphoryl]butylcarbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 121266489) has the molecular formula C25H39F9N3O7P and a molecular weight of 695.56 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[1-[2,2,3,3,3-pentafluoropropoxy(2,2,3,3-tetrafluoropropoxy)phosphoryl]butylcarbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[1-[2,2,3,3,3-pentafluoropropoxy(2,2,3,3-tetrafluoropropoxy)phosphoryl]butylcarbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 121266489 |
| Molecular Formula | C25H39F9N3O7P |
| Molecular Weight | 695.56 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[1-[2,2,3,3,3-pentafluoropropoxy(2,2,3,3-tetrafluoropropoxy)phosphoryl]butylcarbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | CCCC(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)P(=O)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H39F9N3O7P/c1-7-9-16(45(41,42-12-23(28,29)20(26)27)43-13-24(30,31)25(32,33)34)35-18(38)15-10-8-11-37(15)19(39)17(14(2)3)36-21(40)44-22(4,5)6/h14-17,20H,7-13H2,1-6H3,(H,35,38)(H,36,40)/t15-,16?,17-,45?/m0/s1 |
| InChIKey | HNIFFEBLKSITHR-YOQCWIOYSA-N |
| XLogP | 6.09 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|