C28H27N3O8 — CID 10437110
(4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(2-pyridin-2-ylacetyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10437110) has the molecular formula C28H27N3O8 and a molecular weight of 533.54 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(2-pyridin-2-ylacetyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(2-pyridin-2-ylacetyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10437110 |
| Molecular Formula | C28H27N3O8 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-(2-pyridin-2-ylacetyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(C(=O)Cc5ccccn5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C28H27N3O8/c1-31(2)22-16-10-12-9-15-14(18(33)11-13-5-3-4-8-30-13)6-7-17(32)20(15)23(34)19(12)25(36)28(16,39)26(37)21(24(22)35)27(29)38/h3-8,12,16,19,21-22,32,39H,9-11H2,1-2H3,(H2,29,38)/t12-,16-,19?,21?,22-,28-/m1/s1 |
| InChIKey | BOTSMJQZIJGILH-CTVZZPNDSA-N |
| XLogP | -0.31 |
| TPSA | 185.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|