C28H29FN8O3 — CID 10437387
[(2S,4S)-2-(hydroxymethyl)piperidin-4-yl] N-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate (PubChem CID 10437387) has the molecular formula C28H29FN8O3 and a molecular weight of 544.59 g/mol. Its IUPAC name is [(2S,4S)-2-(hydroxymethyl)piperidin-4-yl] N-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate.
| Compound Name | [(2S,4S)-2-(hydroxymethyl)piperidin-4-yl] N-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
|---|---|
| PubChem CID | 10437387 |
| Molecular Formula | C28H29FN8O3 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(2S,4S)-2-(hydroxymethyl)piperidin-4-yl] N-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
| SMILES | Cc1c(NC(=O)O[C@H]2CCN[C@H](CO)C2)cn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C28H29FN8O3/c1-17-24(35-28(39)40-23-7-8-30-22(11-23)15-38)14-37-26(17)27(31-16-33-37)34-21-5-6-25-19(10-21)12-32-36(25)13-18-3-2-4-20(29)9-18/h2-6,9-10,12,14,16,22-23,30,38H,7-8,11,13,15H2,1H3,(H,35,39)(H,31,33,34)/t22-,23-/m0/s1 |
| InChIKey | AKHOEUOTDHBUKQ-GOTSBHOMSA-N |
| XLogP | 3.98 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |