C33H36Cl2N2O5 — CID 10438725
N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 10438725) has the molecular formula C33H36Cl2N2O5 and a molecular weight of 611.57 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 10438725 |
| Molecular Formula | C33H36Cl2N2O5 |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | COc1ccc(CN(C(=O)C2=C(c3ccc(OCCOc4c(Cl)cc(C)cc4Cl)cc3)CCNC2)C2CC2)cc1OC |
| InChI | InChI=1S/C33H36Cl2N2O5/c1-21-16-28(34)32(29(35)17-21)42-15-14-41-25-9-5-23(6-10-25)26-12-13-36-19-27(26)33(38)37(24-7-8-24)20-22-4-11-30(39-2)31(18-22)40-3/h4-6,9-11,16-18,24,36H,7-8,12-15,19-20H2,1-3H3 |
| InChIKey | VRPGPAGCRYVLMT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|