C32H32F4N2O3 — CID 10325664
N-cyclopropyl-N-[(2-fluoro-5-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 10325664) has the molecular formula C32H32F4N2O3 and a molecular weight of 568.61 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluoro-5-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | N-cyclopropyl-N-[(2-fluoro-5-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 10325664 |
| Molecular Formula | C32H32F4N2O3 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluoro-5-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | COc1ccc(F)c(CN(C(=O)C2=C(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)CCNC2)C2CC2)c1 |
| InChI | InChI=1S/C32H32F4N2O3/c1-40-24-10-11-27(33)22(17-24)19-38(23-8-9-23)32(39)26-18-37-15-14-25(26)21-6-4-20(5-7-21)3-2-16-41-31-29(35)13-12-28(34)30(31)36/h4-7,10-13,17,23,37H,2-3,8-9,14-16,18-19H2,1H3 |
| InChIKey | QAGNFLCUCZFIDL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|