C31H27Cl3F4N2O2 — CID 11365730
4-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-5,5-difluoro-2,6-dihydro-1H-pyridine-3-carboxamide (PubChem CID 11365730) has the molecular formula C31H27Cl3F4N2O2 and a molecular weight of 641.92 g/mol. Its IUPAC name is 4-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-5,5-difluoro-2,6-dihydro-1H-pyridine-3-carboxamide.
| Compound Name | 4-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-5,5-difluoro-2,6-dihydro-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11365730 |
| Molecular Formula | C31H27Cl3F4N2O2 |
| Molecular Weight | 641.92 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 4-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-5,5-difluoro-2,6-dihydro-1H-pyridine-3-carboxamide |
| SMILES | O=C(C1=C(c2ccc(CCCOc3c(F)ccc(F)c3Cl)cc2)C(F)(F)CNC1)N(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C31H27Cl3F4N2O2/c32-23-5-1-4-20(27(23)33)16-40(21-10-11-21)30(41)22-15-39-17-31(37,38)26(22)19-8-6-18(7-9-19)3-2-14-42-29-25(36)13-12-24(35)28(29)34/h1,4-9,12-13,21,39H,2-3,10-11,14-17H2 |
| InChIKey | KZRLJNKWCZPQKO-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.92 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|