C26H25Cl3F2N2O2 — CID 70319273
2-(aminomethyl)-3-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-[(2,3-dichlorophenyl)methyl]propanamide (PubChem CID 70319273) has the molecular formula C26H25Cl3F2N2O2 and a molecular weight of 541.85 g/mol. Its IUPAC name is 2-(aminomethyl)-3-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-[(2,3-dichlorophenyl)methyl]propanamide.
| Compound Name | 2-(aminomethyl)-3-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-[(2,3-dichlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 70319273 |
| Molecular Formula | C26H25Cl3F2N2O2 |
| Molecular Weight | 541.85 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 2-(aminomethyl)-3-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-[(2,3-dichlorophenyl)methyl]propanamide |
| SMILES | NCC(Cc1ccc(CCCOc2c(F)ccc(F)c2Cl)cc1)C(=O)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C26H25Cl3F2N2O2/c27-20-5-1-4-18(23(20)28)15-33-26(34)19(14-32)13-17-8-6-16(7-9-17)3-2-12-35-25-22(31)11-10-21(30)24(25)29/h1,4-11,19H,2-3,12-15,32H2,(H,33,34) |
| InChIKey | UYJMUWQQZCBNHU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|