C10H10Cl2N2O2 — CID 148837488
3-amino-N-[(2,3-dichlorophenyl)methyl]-2-oxopropanamide (PubChem CID 148837488) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 3-amino-N-[(2,3-dichlorophenyl)methyl]-2-oxopropanamide.
| Compound Name | 3-amino-N-[(2,3-dichlorophenyl)methyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 148837488 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 3-amino-N-[(2,3-dichlorophenyl)methyl]-2-oxopropanamide |
| SMILES | NCC(=O)C(=O)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2N2O2/c11-7-3-1-2-6(9(7)12)5-14-10(16)8(15)4-13/h1-3H,4-5,13H2,(H,14,16) |
| InChIKey | OUWMOZYLHDJRKY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|