C32H32ClF3N2O2 — CID 10437970
N-[2-(2-chlorophenyl)ethyl]-N-cyclopropyl-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 10437970) has the molecular formula C32H32ClF3N2O2 and a molecular weight of 569.07 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-N-cyclopropyl-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-N-cyclopropyl-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 10437970 |
| Molecular Formula | C32H32ClF3N2O2 |
| Molecular Weight | 569.07 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-N-cyclopropyl-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | O=C(C1=C(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)CCNC1)N(CCc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C32H32ClF3N2O2/c33-27-6-2-1-5-23(27)16-18-38(24-11-12-24)32(39)26-20-37-17-15-25(26)22-9-7-21(8-10-22)4-3-19-40-31-29(35)14-13-28(34)30(31)36/h1-2,5-10,13-14,24,37H,3-4,11-12,15-20H2 |
| InChIKey | DOXUDNPSZOLHMI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.07 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|