C34H34F6N2O4 — CID 87915735
N-cyclopropyl-N-[(2-methylphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87915735) has the molecular formula C34H34F6N2O4 and a molecular weight of 648.64 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-methylphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-N-[(2-methylphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87915735 |
| Molecular Formula | C34H34F6N2O4 |
| Molecular Weight | 648.64 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | N-cyclopropyl-N-[(2-methylphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccccc1CN(C(=O)C1=C(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)CCNC1)C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H33F3N2O2.C2HF3O2/c1-21-5-2-3-7-24(21)20-37(25-12-13-25)32(38)27-19-36-17-16-26(27)23-10-8-22(9-11-23)6-4-18-39-31-29(34)15-14-28(33)30(31)35;3-2(4,5)1(6)7/h2-3,5,7-11,14-15,25,36H,4,6,12-13,16-20H2,1H3;(H,6,7) |
| InChIKey | GKWASWXFOPDLLA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|