C35H33ClF3N3O6 — CID 142670172
6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,9-dicarboxylic acid (PubChem CID 142670172) has the molecular formula C35H33ClF3N3O6 and a molecular weight of 684.11 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,9-dicarboxylic acid.
| Compound Name | 6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,9-dicarboxylic acid |
|---|---|
| PubChem CID | 142670172 |
| Molecular Formula | C35H33ClF3N3O6 |
| Molecular Weight | 684.11 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,9-dicarboxylic acid |
| SMILES | O=C(O)N1CC2CC(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)=C(C(=O)N(Cc3ccccc3Cl)C3CC3)C(C1)N2C(=O)O |
| InChI | InChI=1S/C35H33ClF3N3O6/c36-26-6-2-1-5-22(26)17-41(23-11-12-23)33(43)30-25(16-24-18-40(34(44)45)19-29(30)42(24)35(46)47)21-9-7-20(8-10-21)4-3-15-48-32-28(38)14-13-27(37)31(32)39/h1-2,5-10,13-14,23-24,29H,3-4,11-12,15-19H2,(H,44,45)(H,46,47) |
| InChIKey | XTRVFSXILOPCCU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.11 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|