C35H36F3N3O6 — CID 90749231
(1R,5S)-6-[cyclopropyl-[(3-methoxyphenoxy)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid (PubChem CID 90749231) has the molecular formula C35H36F3N3O6 and a molecular weight of 651.68 g/mol. Its IUPAC name is (1R,5S)-6-[cyclopropyl-[(3-methoxyphenoxy)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid.
| Compound Name | (1R,5S)-6-[cyclopropyl-[(3-methoxyphenoxy)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 90749231 |
| Molecular Formula | C35H36F3N3O6 |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | (1R,5S)-6-[cyclopropyl-[(3-methoxyphenoxy)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid |
| SMILES | COc1cccc(OCN(C(=O)C2=C(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)C[C@@H]3CNC[C@H]2N3C(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C35H36F3N3O6/c1-45-25-5-2-6-26(17-25)47-20-40(23-11-12-23)34(42)31-27(16-24-18-39-19-30(31)41(24)35(43)44)22-9-7-21(8-10-22)4-3-15-46-33-29(37)14-13-28(36)32(33)38/h2,5-10,13-14,17,23-24,30,39H,3-4,11-12,15-16,18-20H2,1H3,(H,43,44)/t24-,30-/m1/s1 |
| InChIKey | GVRAWDBEYVOPLI-AYWVHJORSA-N |
| XLogP | 5.63 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|