C33H35F3N2O5 — CID 69386924
N-cyclopropyl-N-[(3-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide;formic acid (PubChem CID 69386924) has the molecular formula C33H35F3N2O5 and a molecular weight of 596.65 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide;formic acid.
| Compound Name | N-cyclopropyl-N-[(3-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 69386924 |
| Molecular Formula | C33H35F3N2O5 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | N-cyclopropyl-N-[(3-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide;formic acid |
| SMILES | COc1cccc(CN(C(=O)C2CNCC=C2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c1.O=CO |
| InChI | InChI=1S/C32H33F3N2O3.CH2O2/c1-39-25-6-2-4-22(18-25)20-37(24-11-12-24)32(38)27-19-36-16-15-26(27)23-9-7-21(8-10-23)5-3-17-40-31-29(34)14-13-28(33)30(31)35;2-1-3/h2,4,6-10,13-15,18,24,27,36H,3,5,11-12,16-17,19-20H2,1H3;1H,(H,2,3) |
| InChIKey | YTNZHEWTKASBDL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|