C32H34F3N3O4 — CID 57398773
(2R)-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide (PubChem CID 57398773) has the molecular formula C32H34F3N3O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 57398773 |
| Molecular Formula | C32H34F3N3O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
| SMILES | COc1cccc(CN(C(=O)[C@H]2CNCC(=O)N2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c1C |
| InChI | InChI=1S/C32H34F3N3O4/c1-20-22(6-3-7-28(20)41-2)19-37(23-12-13-23)32(40)27-17-36-18-29(39)38(27)24-10-8-21(9-11-24)5-4-16-42-31-26(34)15-14-25(33)30(31)35/h3,6-11,14-15,23,27,36H,4-5,12-13,16-19H2,1-2H3/t27-/m1/s1 |
| InChIKey | MCCGHSKVLQQARB-HHHXNRCGSA-N |
| XLogP | 4.93 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|