C32H36ClN3O3 — CID 57392366
(2R)-1-[4-[3-(3-chlorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dimethylphenyl)methyl]-6-oxopiperazine-2-carboxamide (PubChem CID 57392366) has the molecular formula C32H36ClN3O3 and a molecular weight of 546.11 g/mol. Its IUPAC name is (2R)-1-[4-[3-(3-chlorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dimethylphenyl)methyl]-6-oxopiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-[3-(3-chlorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dimethylphenyl)methyl]-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 57392366 |
| Molecular Formula | C32H36ClN3O3 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2R)-1-[4-[3-(3-chlorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2,3-dimethylphenyl)methyl]-6-oxopiperazine-2-carboxamide |
| SMILES | Cc1cccc(CN(C(=O)[C@H]2CNCC(=O)N2c2ccc(CCCOc3cccc(Cl)c3)cc2)C2CC2)c1C |
| InChI | InChI=1S/C32H36ClN3O3/c1-22-6-3-8-25(23(22)2)21-35(27-15-16-27)32(38)30-19-34-20-31(37)36(30)28-13-11-24(12-14-28)7-5-17-39-29-10-4-9-26(33)18-29/h3-4,6,8-14,18,27,30,34H,5,7,15-17,19-21H2,1-2H3/t30-/m1/s1 |
| InChIKey | TWTGJMFPSNMKRT-SSEXGKCCSA-N |
| XLogP | 5.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|