C30H29ClF3N3O3 — CID 57392554
(2R)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide (PubChem CID 57392554) has the molecular formula C30H29ClF3N3O3 and a molecular weight of 572.03 g/mol. Its IUPAC name is (2R)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 57392554 |
| Molecular Formula | C30H29ClF3N3O3 |
| Molecular Weight | 572.03 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | (2R)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
| SMILES | O=C([C@H]1CNCC(=O)N1c1ccc(CCCOc2c(F)ccc(F)c2F)cc1)N(Cc1cccc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C30H29ClF3N3O3/c31-21-5-1-3-20(15-21)18-36(22-10-11-22)30(39)26-16-35-17-27(38)37(26)23-8-6-19(7-9-23)4-2-14-40-29-25(33)13-12-24(32)28(29)34/h1,3,5-9,12-13,15,22,26,35H,2,4,10-11,14,16-18H2/t26-/m1/s1 |
| InChIKey | ZELIMDBCVOCTPX-AREMUKBSSA-N |
| XLogP | 5.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|