C34H36ClF3N4O4 — CID 57401538
(2R)-N-[[2-chloro-5-[(propanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide (PubChem CID 57401538) has the molecular formula C34H36ClF3N4O4 and a molecular weight of 657.13 g/mol. Its IUPAC name is (2R)-N-[[2-chloro-5-[(propanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-N-[[2-chloro-5-[(propanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 57401538 |
| Molecular Formula | C34H36ClF3N4O4 |
| Molecular Weight | 657.13 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | (2R)-N-[[2-chloro-5-[(propanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
| SMILES | CCC(=O)NCc1ccc(Cl)c(CN(C(=O)[C@H]2CNCC(=O)N2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C34H36ClF3N4O4/c1-2-30(43)40-17-22-7-12-26(35)23(16-22)20-41(24-10-11-24)34(45)29-18-39-19-31(44)42(29)25-8-5-21(6-9-25)4-3-15-46-33-28(37)14-13-27(36)32(33)38/h5-9,12-14,16,24,29,39H,2-4,10-11,15,17-20H2,1H3,(H,40,43)/t29-/m1/s1 |
| InChIKey | JCTWRANIWWXHMU-GDLZYMKVSA-N |
| XLogP | 5.29 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|