C32H33F3N2O3 — CID 69381037
[4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridin-3-yl] N-cyclopropyl-N-[(3-methylphenyl)methyl]carbamate (PubChem CID 69381037) has the molecular formula C32H33F3N2O3 and a molecular weight of 550.62 g/mol. Its IUPAC name is [4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridin-3-yl] N-cyclopropyl-N-[(3-methylphenyl)methyl]carbamate.
| Compound Name | [4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridin-3-yl] N-cyclopropyl-N-[(3-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69381037 |
| Molecular Formula | C32H33F3N2O3 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridin-3-yl] N-cyclopropyl-N-[(3-methylphenyl)methyl]carbamate |
| SMILES | Cc1cccc(CN(C(=O)OC2CNCC=C2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C32H33F3N2O3/c1-21-4-2-5-23(18-21)20-37(25-11-12-25)32(38)40-29-19-36-16-15-26(29)24-9-7-22(8-10-24)6-3-17-39-31-28(34)14-13-27(33)30(31)35/h2,4-5,7-10,13-15,18,25,29,36H,3,6,11-12,16-17,19-20H2,1H3 |
| InChIKey | HUBVLFBNTHMAHB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|