C34H33F4N3O4 — CID 142670384
6-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid (PubChem CID 142670384) has the molecular formula C34H33F4N3O4 and a molecular weight of 623.65 g/mol. Its IUPAC name is 6-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid.
| Compound Name | 6-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 142670384 |
| Molecular Formula | C34H33F4N3O4 |
| Molecular Weight | 623.65 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | 6-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-9-carboxylic acid |
| SMILES | O=C(C1=C(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)CC2CNCC1N2C(=O)O)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C34H33F4N3O4/c35-26-6-2-1-5-22(26)19-40(23-11-12-23)33(42)30-25(16-24-17-39-18-29(30)41(24)34(43)44)21-9-7-20(8-10-21)4-3-15-45-32-28(37)14-13-27(36)31(32)38/h1-2,5-10,13-14,23-24,29,39H,3-4,11-12,15-19H2,(H,43,44) |
| InChIKey | UJRUTUOGTAOXGC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|