C37H37ClF3N3O5 — CID 10349730
4-[(1R,5S)-6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-en-9-yl]-4-oxobutanoic acid (PubChem CID 10349730) has the molecular formula C37H37ClF3N3O5 and a molecular weight of 696.17 g/mol. Its IUPAC name is 4-[(1R,5S)-6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-en-9-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(1R,5S)-6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-en-9-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10349730 |
| Molecular Formula | C37H37ClF3N3O5 |
| Molecular Weight | 696.17 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | 4-[(1R,5S)-6-[(2-chlorophenyl)methyl-cyclopropylcarbamoyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-en-9-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1[C@H]2CNC[C@@H]1C(C(=O)N(Cc1ccccc1Cl)C1CC1)=C(c1ccc(CCCOc3c(F)ccc(F)c3F)cc1)C2 |
| InChI | InChI=1S/C37H37ClF3N3O5/c38-28-6-2-1-5-24(28)21-43(25-11-12-25)37(48)34-27(18-26-19-42-20-31(34)44(26)32(45)15-16-33(46)47)23-9-7-22(8-10-23)4-3-17-49-36-30(40)14-13-29(39)35(36)41/h1-2,5-10,13-14,25-26,31,42H,3-4,11-12,15-21H2,(H,46,47)/t26-,31-/m1/s1 |
| InChIKey | GOHPDQSXXBUKAB-MXBOTTGLSA-N |
| XLogP | 6.15 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.17 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|