C32H33F3N2O3 — CID 11432824
N-cyclopropyl-N-[(2-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide (PubChem CID 11432824) has the molecular formula C32H33F3N2O3 and a molecular weight of 550.62 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(2-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 11432824 |
| Molecular Formula | C32H33F3N2O3 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-cyclopropyl-N-[(2-methoxyphenyl)methyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-1,2,3,6-tetrahydropyridine-3-carboxamide |
| SMILES | COc1ccccc1CN(C(=O)C1CNCC=C1c1ccc(CCCOc2c(F)ccc(F)c2F)cc1)C1CC1 |
| InChI | InChI=1S/C32H33F3N2O3/c1-39-29-7-3-2-6-23(29)20-37(24-12-13-24)32(38)26-19-36-17-16-25(26)22-10-8-21(9-11-22)5-4-18-40-31-28(34)15-14-27(33)30(31)35/h2-3,6-11,14-16,24,26,36H,4-5,12-13,17-20H2,1H3 |
| InChIKey | DSOMRVWXRYDNJM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|