C36H39BrF3N3O7 — CID 70312388
4-(dihydroxyamino)oxybutyl 3-[(2-bromophenyl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 70312388) has the molecular formula C36H39BrF3N3O7 and a molecular weight of 762.62 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 3-[(2-bromophenyl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 3-[(2-bromophenyl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 70312388 |
| Molecular Formula | C36H39BrF3N3O7 |
| Molecular Weight | 762.62 g/mol |
| Exact Mass | 761.19 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 3-[(2-bromophenyl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCCCCON(O)O)N1CC=C(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C(C(=O)N(Cc2ccccc2Br)C2CC2)C1 |
| InChI | InChI=1S/C36H39BrF3N3O7/c37-30-8-2-1-7-26(30)22-42(27-13-14-27)35(44)29-23-41(36(45)49-19-3-4-21-50-43(46)47)18-17-28(29)25-11-9-24(10-12-25)6-5-20-48-34-32(39)16-15-31(38)33(34)40/h1-2,7-12,15-17,27,29,46-47H,3-6,13-14,18-23H2 |
| InChIKey | DZXJYGIEKUMLIY-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|