C30H29Cl2F3N4O3 — CID 68570998
(5S)-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]-1,3-oxazol-2-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 68570998) has the molecular formula C30H29Cl2F3N4O3 and a molecular weight of 621.49 g/mol. Its IUPAC name is (5S)-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]-1,3-oxazol-2-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (5S)-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]-1,3-oxazol-2-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 68570998 |
| Molecular Formula | C30H29Cl2F3N4O3 |
| Molecular Weight | 621.49 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | (5S)-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]-1,3-oxazol-2-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | O=C(C1=C(c2nc(CCCOc3c(F)ccc(F)c3F)co2)CC2CNC[C@H]1N2)N(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C30H29Cl2F3N4O3/c31-21-5-1-3-16(26(21)32)14-39(19-6-7-19)30(40)25-20(11-18-12-36-13-24(25)37-18)29-38-17(15-42-29)4-2-10-41-28-23(34)9-8-22(33)27(28)35/h1,3,5,8-9,15,18-19,24,36-37H,2,4,6-7,10-14H2/t18?,24-/m1/s1 |
| InChIKey | GVDSGDJSDZAGLQ-VCUSLETLSA-N |
| XLogP | 5.69 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|