C33H26FN2O7P — CID 10438740
5-[bis(phenylmethoxy)phosphorylmethoxy]-7-[(4-fluorophenyl)methyl]-9-hydroxypyrrolo[3,4-g]quinoline-6,8-dione (PubChem CID 10438740) has the molecular formula C33H26FN2O7P and a molecular weight of 612.55 g/mol. Its IUPAC name is 5-[bis(phenylmethoxy)phosphorylmethoxy]-7-[(4-fluorophenyl)methyl]-9-hydroxypyrrolo[3,4-g]quinoline-6,8-dione.
| Compound Name | 5-[bis(phenylmethoxy)phosphorylmethoxy]-7-[(4-fluorophenyl)methyl]-9-hydroxypyrrolo[3,4-g]quinoline-6,8-dione |
|---|---|
| PubChem CID | 10438740 |
| Molecular Formula | C33H26FN2O7P |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 5-[bis(phenylmethoxy)phosphorylmethoxy]-7-[(4-fluorophenyl)methyl]-9-hydroxypyrrolo[3,4-g]quinoline-6,8-dione |
| SMILES | O=C1c2c(c(O)c3ncccc3c2OCP(=O)(OCc2ccccc2)OCc2ccccc2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C33H26FN2O7P/c34-25-15-13-22(14-16-25)18-36-32(38)27-28(33(36)39)31(26-12-7-17-35-29(26)30(27)37)41-21-44(40,42-19-23-8-3-1-4-9-23)43-20-24-10-5-2-6-11-24/h1-17,37H,18-21H2 |
| InChIKey | TZTMQSGFIAHELL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|