C35H40N2O16P2 — CID 10441463
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R,4S,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl] hydrogen phosphate (PubChem CID 10441463) has the molecular formula C35H40N2O16P2 and a molecular weight of 806.65 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R,4S,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R,4S,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 10441463 |
| Molecular Formula | C35H40N2O16P2 |
| Molecular Weight | 806.65 g/mol |
| Exact Mass | 806.19 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R,4S,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl] hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC3OCC(OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C35H40N2O16P2/c38-28-16-17-37(35(41)36-28)33-30(40)29(39)26(51-33)22-50-54(42,43)53-55(44,45)52-34-32(48-20-25-14-8-3-9-15-25)31(47-19-24-12-6-2-7-13-24)27(21-49-34)46-18-23-10-4-1-5-11-23/h1-17,26-27,29-34,39-40H,18-22H2,(H,42,43)(H,44,45)(H,36,38,41)/t26-,27?,29-,30-,31+,32-,33-,34?/m1/s1 |
| InChIKey | OKNNPUZFCUFQCQ-CLOWFYFWSA-N |
| XLogP | 2.52 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|