C12H11N3 — CID 10442691
1,9-dimethylimidazo[4,5-c]quinoline (PubChem CID 10442691) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,9-dimethylimidazo[4,5-c]quinoline.
| Compound Name | 1,9-dimethylimidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 10442691 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1,9-dimethylimidazo[4,5-c]quinoline |
| SMILES | Cc1cccc2ncc3ncn(C)c3c12 |
| InChI | InChI=1S/C12H11N3/c1-8-4-3-5-9-11(8)12-10(6-13-9)14-7-15(12)2/h3-7H,1-2H3 |
| InChIKey | QUJQEXUIXWIUTD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |