C15H21N — CID 10443274
(3aR,9bR)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole (PubChem CID 10443274) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (3aR,9bR)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole.
| Compound Name | (3aR,9bR)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 10443274 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (3aR,9bR)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
| SMILES | CCCN1CC[C@@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C15H21N/c1-2-10-16-11-9-14-13-6-4-3-5-12(13)7-8-15(14)16/h3-6,14-15H,2,7-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ANSBSVSYIULXCZ-HUUCEWRRSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |