C17H33N — CID 10444882
3-ethyl-1-hexyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 10444882) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 3-ethyl-1-hexyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 3-ethyl-1-hexyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 10444882 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 3-ethyl-1-hexyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCCCCC1CC(CC)CN2CCCCC12 |
| InChI | InChI=1S/C17H33N/c1-3-5-6-7-10-16-13-15(4-2)14-18-12-9-8-11-17(16)18/h15-17H,3-14H2,1-2H3 |
| InChIKey | OQISCFMQIXIKQP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|