C16H29NO — CID 163499514
1-(3-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 163499514) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-(3-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(3-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 163499514 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-(3-ethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCC1CC(C(=O)C(C)(C)C)C2CCCCN2C1 |
| InChI | InChI=1S/C16H29NO/c1-5-12-10-13(15(18)16(2,3)4)14-8-6-7-9-17(14)11-12/h12-14H,5-11H2,1-4H3 |
| InChIKey | XTRJWMOIIYKKOE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |