About 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one (PubChem CID 6430124) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one.
Molecular Properties
| Compound Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one |
| PubChem CID | 6430124 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one |
| SMILES | O=C1C2CN3CCCCC3C1CN1CCCCC21 |
| InChI | InChI=1S/C15H24N2O/c18-15-11-9-17-8-4-2-6-14(17)12(15)10-16-7-3-1-5-13(11)16/h11-14H,1-10H2 |
| InChIKey | GHGQXOFLRGUXQS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one (CID 6430124) is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one.
What is the SMILES notation for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The canonical SMILES for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one is O=C1C2CN3CCCCC3C1CN1CCCCC21.
What is the InChIKey of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The InChIKey is GHGQXOFLRGUXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c18-15-11-9-17-8-4-2-6-14(17)12(15)10-16-7-3-1-5-13(11)16/h11-14H,1-10H2.
What are the key properties of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one has a molecular weight of 248.37 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one is sourced from PubChem (CID 6430124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).