About 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one (PubChem CID 6430124) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one.
Analyze 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one (CID 6430124) is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one.
What is the SMILES notation for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The canonical SMILES for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one is O=C1C2CN3CCCCC3C1CN1CCCCC21.
What is the InChIKey of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
The InChIKey is GHGQXOFLRGUXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c18-15-11-9-17-8-4-2-6-14(17)12(15)10-16-7-3-1-5-13(11)16/h11-14H,1-10H2.
What are the key properties of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one?
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one has a molecular weight of 248.37 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-17-one is sourced from PubChem (CID 6430124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).