C15H27ClN2 — CID 169440912
(1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride (PubChem CID 169440912) has the molecular formula C15H27ClN2 and a molecular weight of 270.85 g/mol. Its IUPAC name is (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride.
| Compound Name | (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride |
|---|---|
| PubChem CID | 169440912 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride |
| SMILES | C1CCN2C[C@@H]3C[C@@H](CN4CCCC[C@H]34)[C@H]2C1.Cl |
| InChI | InChI=1S/C15H26N2.ClH/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;/h12-15H,1-11H2;1H/t12-,13-,14+,15+;/m0./s1 |
| InChIKey | RMSLOXMMNWLOAB-FFIJQSHZSA-N |
| XLogP | 2.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |