C15H12F2N2 — CID 10445220
8-fluoro-3-(4-fluorophenyl)-3,4-dihydroisoquinolin-1-amine (PubChem CID 10445220) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 8-fluoro-3-(4-fluorophenyl)-3,4-dihydroisoquinolin-1-amine.
| Compound Name | 8-fluoro-3-(4-fluorophenyl)-3,4-dihydroisoquinolin-1-amine |
|---|---|
| PubChem CID | 10445220 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 8-fluoro-3-(4-fluorophenyl)-3,4-dihydroisoquinolin-1-amine |
| SMILES | NC1=NC(c2ccc(F)cc2)Cc2cccc(F)c21 |
| InChI | InChI=1S/C15H12F2N2/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13H,8H2,(H2,18,19) |
| InChIKey | LCRLDHTZCMPEPS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |