C12H9ClN2O4 — CID 10446416
(3Z,5Z)-5-[(2-chlorophenyl)-methoxymethylidene]-3-hydroxyiminopyrrolidine-2,4-dione (PubChem CID 10446416) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is (3Z,5Z)-5-[(2-chlorophenyl)-methoxymethylidene]-3-hydroxyiminopyrrolidine-2,4-dione.
| Compound Name | (3Z,5Z)-5-[(2-chlorophenyl)-methoxymethylidene]-3-hydroxyiminopyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 10446416 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (3Z,5Z)-5-[(2-chlorophenyl)-methoxymethylidene]-3-hydroxyiminopyrrolidine-2,4-dione |
| SMILES | CO/C(=C1\NC(=O)/C(=N\O)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H9ClN2O4/c1-19-11(6-4-2-3-5-7(6)13)8-10(16)9(15-18)12(17)14-8/h2-5,18H,1H3,(H,14,17)/b11-8-,15-9- |
| InChIKey | FAZFYAYOPDGZLD-BTTAZIECSA-N |
| XLogP | 1.18 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|