C12H10N2O4 — CID 22733467
(3Z,5E)-3-hydroxyimino-5-[methoxy(phenyl)methylidene]pyrrolidine-2,4-dione (PubChem CID 22733467) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is (3Z,5E)-3-hydroxyimino-5-[methoxy(phenyl)methylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z,5E)-3-hydroxyimino-5-[methoxy(phenyl)methylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 22733467 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (3Z,5E)-3-hydroxyimino-5-[methoxy(phenyl)methylidene]pyrrolidine-2,4-dione |
| SMILES | CO/C(=C1/NC(=O)/C(=N\O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C12H10N2O4/c1-18-11(7-5-3-2-4-6-7)8-10(15)9(14-17)12(16)13-8/h2-6,17H,1H3,(H,13,16)/b11-8+,14-9- |
| InChIKey | UVJKSRVEYGJDIT-GZESYCOQSA-N |
| XLogP | 0.53 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|