C18H11ClN2 — CID 10446974
4-chloro-5-phenylbenzo[c][2,7]naphthyridine (PubChem CID 10446974) has the molecular formula C18H11ClN2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-chloro-5-phenylbenzo[c][2,7]naphthyridine.
| Compound Name | 4-chloro-5-phenylbenzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 10446974 |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-chloro-5-phenylbenzo[c][2,7]naphthyridine |
| SMILES | Clc1nccc2c1c(-c1ccccc1)nc1ccccc12 |
| InChI | InChI=1S/C18H11ClN2/c19-18-16-14(10-11-20-18)13-8-4-5-9-15(13)21-17(16)12-6-2-1-3-7-12/h1-11H |
| InChIKey | AOPZORJJEPABBF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|