C15H9ClN4O — CID 10447302
10-chloro-9-methoxycinnolino[3,4-b]quinoxaline (PubChem CID 10447302) has the molecular formula C15H9ClN4O and a molecular weight of 296.72 g/mol. Its IUPAC name is 10-chloro-9-methoxycinnolino[3,4-b]quinoxaline.
| Compound Name | 10-chloro-9-methoxycinnolino[3,4-b]quinoxaline |
|---|---|
| PubChem CID | 10447302 |
| Molecular Formula | C15H9ClN4O |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 10-chloro-9-methoxycinnolino[3,4-b]quinoxaline |
| SMILES | COc1cc2nc3nnc4ccccc4c3nc2cc1Cl |
| InChI | InChI=1S/C15H9ClN4O/c1-21-13-7-12-11(6-9(13)16)17-14-8-4-2-3-5-10(8)19-20-15(14)18-12/h2-7H,1H3 |
| InChIKey | KOGDQSLQQQPBNE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|