C15H26O4S — CID 10447718
(4S)-4-[(1R)-1-deuterioethyl]-4-[(3R)-3-methyl-4-(oxan-2-yloxy)butyl]-1,3-dioxolane-2-thione (PubChem CID 10447718) has the molecular formula C15H26O4S and a molecular weight of 303.44 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-deuterioethyl]-4-[(3R)-3-methyl-4-(oxan-2-yloxy)butyl]-1,3-dioxolane-2-thione.
| Compound Name | (4S)-4-[(1R)-1-deuterioethyl]-4-[(3R)-3-methyl-4-(oxan-2-yloxy)butyl]-1,3-dioxolane-2-thione |
|---|---|
| PubChem CID | 10447718 |
| Molecular Formula | C15H26O4S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (4S)-4-[(1R)-1-deuterioethyl]-4-[(3R)-3-methyl-4-(oxan-2-yloxy)butyl]-1,3-dioxolane-2-thione |
| SMILES | [2H][C@H](C)[C@]1(CC[C@@H](C)COC2CCCCO2)COC(=S)O1 |
| InChI | InChI=1S/C15H26O4S/c1-3-15(11-18-14(20)19-15)8-7-12(2)10-17-13-6-4-5-9-16-13/h12-13H,3-11H2,1-2H3/t12-,13?,15+/m1/s1/i3D/t3-,12-,13?,15+ |
| InChIKey | GVTOVPHHYITFGL-MTYWCDEBSA-N |
| XLogP | 3.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|