C16H20N2O4 — CID 10447754
ethyl 4-hydroxy-6-oxo-3-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyridazine-5-carboxylate (PubChem CID 10447754) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 4-hydroxy-6-oxo-3-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyridazine-5-carboxylate.
| Compound Name | ethyl 4-hydroxy-6-oxo-3-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 10447754 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethyl 4-hydroxy-6-oxo-3-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyridazine-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NN=C(c2ccc(C(C)C)cc2)C1O |
| InChI | InChI=1S/C16H20N2O4/c1-4-22-16(21)12-14(19)13(17-18-15(12)20)11-7-5-10(6-8-11)9(2)3/h5-9,12,14,19H,4H2,1-3H3,(H,18,20) |
| InChIKey | TZWOYWROEZLSRM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|