C14H13ClO4 — CID 139604107
ethyl 3-(4-chlorophenyl)-2-hydroxy-5-oxocyclopent-3-ene-1-carboxylate (PubChem CID 139604107) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-2-hydroxy-5-oxocyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-2-hydroxy-5-oxocyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 139604107 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-2-hydroxy-5-oxocyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccc(Cl)cc2)C1O |
| InChI | InChI=1S/C14H13ClO4/c1-2-19-14(18)12-11(16)7-10(13(12)17)8-3-5-9(15)6-4-8/h3-7,12-13,17H,2H2,1H3 |
| InChIKey | KCYXWXYNVZPPAF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|