C11H14O4 — CID 11031088
ethyl (1R,6R,6aR)-6-hydroxy-2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 11031088) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl (1R,6R,6aR)-6-hydroxy-2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate.
| Compound Name | ethyl (1R,6R,6aR)-6-hydroxy-2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 11031088 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | ethyl (1R,6R,6aR)-6-hydroxy-2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C2CC[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C11H14O4/c1-2-15-11(14)10-8(13)5-6-3-4-7(12)9(6)10/h5,7,9-10,12H,2-4H2,1H3/t7-,9-,10+/m1/s1 |
| InChIKey | XFLUCYHVUDHHPP-QNSHHTMESA-N |
| XLogP | 0.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|