C23H22O3 — CID 849578
ethyl (1S,2S,10aS)-3-oxo-1-phenyl-2,9,10,10a-tetrahydro-1H-phenanthrene-2-carboxylate (PubChem CID 849578) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl (1S,2S,10aS)-3-oxo-1-phenyl-2,9,10,10a-tetrahydro-1H-phenanthrene-2-carboxylate.
| Compound Name | ethyl (1S,2S,10aS)-3-oxo-1-phenyl-2,9,10,10a-tetrahydro-1H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 849578 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl (1S,2S,10aS)-3-oxo-1-phenyl-2,9,10,10a-tetrahydro-1H-phenanthrene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C2c3ccccc3CC[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H22O3/c1-2-26-23(25)22-20(24)14-19-17-11-7-6-8-15(17)12-13-18(19)21(22)16-9-4-3-5-10-16/h3-11,14,18,21-22H,2,12-13H2,1H3/t18-,21+,22-/m1/s1 |
| InChIKey | MBEZJVHYCSPIDX-BVYCBKJFSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|