C22H38O4Si — CID 11090528
ethyl (1R,6R,6aR)-5,5-dimethyl-2-oxo-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalene-1-carboxylate (PubChem CID 11090528) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is ethyl (1R,6R,6aR)-5,5-dimethyl-2-oxo-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalene-1-carboxylate.
| Compound Name | ethyl (1R,6R,6aR)-5,5-dimethyl-2-oxo-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 11090528 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl (1R,6R,6aR)-5,5-dimethyl-2-oxo-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C2CC(C)(C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]21 |
| InChI | InChI=1S/C22H38O4Si/c1-10-25-21(24)19-17(23)11-16-12-22(8,9)20(18(16)19)26-27(13(2)3,14(4)5)15(6)7/h11,13-15,18-20H,10,12H2,1-9H3/t18-,19-,20+/m0/s1 |
| InChIKey | KUTZRGSBLYCYGO-SLFFLAALSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|