C19H34OSi — CID 10447896
trimethyl-[[(1R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]non-2-enyl]oxy]silane (PubChem CID 10447896) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is trimethyl-[[(1R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]non-2-enyl]oxy]silane.
| Compound Name | trimethyl-[[(1R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]non-2-enyl]oxy]silane |
|---|---|
| PubChem CID | 10447896 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | trimethyl-[[(1R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]non-2-enyl]oxy]silane |
| SMILES | C=CC[C@]1(C)C[C@H]2C(O[Si](C)(C)C)=CCC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C19H34OSi/c1-9-12-18(4)14-15-16(20-21(6,7)8)11-10-13-19(18,5)17(15,2)3/h9,11,15H,1,10,12-14H2,2-8H3/t15-,18+,19+/m0/s1 |
| InChIKey | DSCXVKOOVIVQGA-KFKAGJAMSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|