C21H26N2O — CID 10448824
trans-(1R,2R)-2-[benzyl-[(E)-(4-methylphenyl)methylideneamino]amino]cyclohexan-1-ol (PubChem CID 10448824) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is trans-(1R,2R)-2-[benzyl-[(E)-(4-methylphenyl)methylideneamino]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[benzyl-[(E)-(4-methylphenyl)methylideneamino]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10448824 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | trans-(1R,2R)-2-[benzyl-[(E)-(4-methylphenyl)methylideneamino]amino]cyclohexan-1-ol |
| SMILES | Cc1ccc(/C=N/N(Cc2ccccc2)[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C21H26N2O/c1-17-11-13-18(14-12-17)15-22-23(16-19-7-3-2-4-8-19)20-9-5-6-10-21(20)24/h2-4,7-8,11-15,20-21,24H,5-6,9-10,16H2,1H3/b22-15+/t20-,21-/m1/s1 |
| InChIKey | COUNHLQCKWULRT-HEHNLYSKSA-N |
| XLogP | 4.13 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|