C14H19FN2O — CID 177408903
trans-(1S,2S)-2-[[(E)-(4-fluorophenyl)methylideneamino]-methylamino]cyclohexan-1-ol (PubChem CID 177408903) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[(E)-(4-fluorophenyl)methylideneamino]-methylamino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[[(E)-(4-fluorophenyl)methylideneamino]-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 177408903 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | trans-(1S,2S)-2-[[(E)-(4-fluorophenyl)methylideneamino]-methylamino]cyclohexan-1-ol |
| SMILES | CN(/N=C/c1ccc(F)cc1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H19FN2O/c1-17(13-4-2-3-5-14(13)18)16-10-11-6-8-12(15)9-7-11/h6-10,13-14,18H,2-5H2,1H3/b16-10+/t13-,14-/m0/s1 |
| InChIKey | CSGWRRQEKLSYGS-UDKOXHGFSA-N |
| XLogP | 2.39 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|