C14H10F6O2 — CID 10448900
1-[4-hydroxy-3,5-bis(trifluoromethyl)phenyl]hex-5-yn-1-one (PubChem CID 10448900) has the molecular formula C14H10F6O2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 1-[4-hydroxy-3,5-bis(trifluoromethyl)phenyl]hex-5-yn-1-one.
| Compound Name | 1-[4-hydroxy-3,5-bis(trifluoromethyl)phenyl]hex-5-yn-1-one |
|---|---|
| PubChem CID | 10448900 |
| Molecular Formula | C14H10F6O2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-[4-hydroxy-3,5-bis(trifluoromethyl)phenyl]hex-5-yn-1-one |
| SMILES | C#CCCCC(=O)c1cc(C(F)(F)F)c(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6O2/c1-2-3-4-5-11(21)8-6-9(13(15,16)17)12(22)10(7-8)14(18,19)20/h1,6-7,22H,3-5H2 |
| InChIKey | OCEDNRZHBHDCTE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|