C21H21N3O — CID 10449382
3,3-diphenyl-2-(piperidine-1-carboximidoyl)oxirane-2-carbonitrile (PubChem CID 10449382) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 3,3-diphenyl-2-(piperidine-1-carboximidoyl)oxirane-2-carbonitrile.
| Compound Name | 3,3-diphenyl-2-(piperidine-1-carboximidoyl)oxirane-2-carbonitrile |
|---|---|
| PubChem CID | 10449382 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3,3-diphenyl-2-(piperidine-1-carboximidoyl)oxirane-2-carbonitrile |
| SMILES | [H]/N=C(\N1CCCCC1)C1(C#N)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O/c22-16-20(19(23)24-14-8-3-9-15-24)21(25-20,17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,23H,3,8-9,14-15H2/b23-19- |
| InChIKey | CQNGWHWRFSMWOQ-NMWGTECJSA-N |
| XLogP | 3.69 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|