C20H20N2O — CID 86062422
1,3-diphenylprop-2-ynyl pyrrolidine-1-carboximidate (PubChem CID 86062422) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 1,3-diphenylprop-2-ynyl pyrrolidine-1-carboximidate.
| Compound Name | 1,3-diphenylprop-2-ynyl pyrrolidine-1-carboximidate |
|---|---|
| PubChem CID | 86062422 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1,3-diphenylprop-2-ynyl pyrrolidine-1-carboximidate |
| SMILES | [H]/N=C(/OC(C#Cc1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H20N2O/c21-20(22-15-7-8-16-22)23-19(18-11-5-2-6-12-18)14-13-17-9-3-1-4-10-17/h1-6,9-12,19,21H,7-8,15-16H2/b21-20+ |
| InChIKey | HINLRHPJKDURIG-QZQOTICOSA-N |
| XLogP | 3.83 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|