C17H12F3NO3 — CID 175039953
[3-phenyl-1-[4-(trifluoromethoxy)phenyl]prop-2-ynyl] carbamate (PubChem CID 175039953) has the molecular formula C17H12F3NO3 and a molecular weight of 335.28 g/mol. Its IUPAC name is [3-phenyl-1-[4-(trifluoromethoxy)phenyl]prop-2-ynyl] carbamate.
| Compound Name | [3-phenyl-1-[4-(trifluoromethoxy)phenyl]prop-2-ynyl] carbamate |
|---|---|
| PubChem CID | 175039953 |
| Molecular Formula | C17H12F3NO3 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [3-phenyl-1-[4-(trifluoromethoxy)phenyl]prop-2-ynyl] carbamate |
| SMILES | NC(=O)OC(C#Cc1ccccc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F3NO3/c18-17(19,20)24-14-9-7-13(8-10-14)15(23-16(21)22)11-6-12-4-2-1-3-5-12/h1-5,7-10,15H,(H2,21,22) |
| InChIKey | YQUHCOQGOFTKMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|